| Melting point |
128-129° |
| Boiling point |
423.1±55.0 °C(Predicted) |
| Density |
1.42±0.1 g/cm3(Predicted) |
| vapor pressure |
0-0Pa at 20-25℃ |
| storage temp. |
-20°C |
| solubility |
Chloroform: Slightly Soluble,Methanol: Slightly Soluble |
| form |
Solid |
| pka |
0.01±0.10(Predicted) |
| color |
White to off-white |
| Henry's Law Constant |
9.0×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application |
agriculture environmental |
| InChI |
InChI=1S/C10H9ClN4S/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12/h1-2,5H,3-4,6H2/b14-10+ |
| InChIKey |
HOKKPVIRMVDYPB-GXDHUFHOSA-N |
| SMILES |
N1(CCS/C/1=N/C#N)CC1=CN=C(Cl)C=C1 |
| LogP |
1.3-1.4 at 24℃ and pH4-9 |
| Surface tension |
72mN/m at 150mg/L and 20℃ |
| CAS DataBase Reference |
111988-49-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Thiacloprid (111988-49-9) |